C10H10N4O2 — CID 118796828
(5-amino-1,2,4-triazol-1-yl)-(4-methoxyphenyl)methanone (PubChem CID 118796828) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is (5-amino-1,2,4-triazol-1-yl)-(4-methoxyphenyl)methanone.
| Compound Name | (5-amino-1,2,4-triazol-1-yl)-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 118796828 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (5-amino-1,2,4-triazol-1-yl)-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)n2ncnc2N)cc1 |
| InChI | InChI=1S/C10H10N4O2/c1-16-8-4-2-7(3-5-8)9(15)14-10(11)12-6-13-14/h2-6H,1H3,(H2,11,12,13) |
| InChIKey | MDFWUVGMSOBSKJ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |