C11H10N2O2 — CID 135146869
methyl 3-ethenylimidazo[1,2-a]pyridine-8-carboxylate (PubChem CID 135146869) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is methyl 3-ethenylimidazo[1,2-a]pyridine-8-carboxylate.
| Compound Name | methyl 3-ethenylimidazo[1,2-a]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 135146869 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | methyl 3-ethenylimidazo[1,2-a]pyridine-8-carboxylate |
| SMILES | C=Cc1cnc2c(C(=O)OC)cccn12 |
| InChI | InChI=1S/C11H10N2O2/c1-3-8-7-12-10-9(11(14)15-2)5-4-6-13(8)10/h3-7H,1H2,2H3 |
| InChIKey | UFEWEXDXYKAXDC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |