methyl 3-(aminomethyl)imidazo[1,2-a]pyridine-8-carboxylate

C10H11N3O2 — CID 117256872

IUPACmethyl 3-(aminomethyl)imidazo[1,2-a]pyridine-8-carboxylate
SMILESCOC(=O)c1cccn2c(CN)cnc12
InChIInChI=1S/C10H11N3O2/c1-15-10(14)8-3-2-4-13-7(5-11)6-12-9(8)13/h2-4,6H,5,11H2,1H3
InChIKeyBJJDHYMYDZGLLA-UHFFFAOYSA-N
MW205.22 g/mol
LogP0.58
Rot. Bonds2

About methyl 3-(aminomethyl)imidazo[1,2-a]pyridine-8-carboxylate

methyl 3-(aminomethyl)imidazo[1,2-a]pyridine-8-carboxylate (PubChem CID 117256872) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is methyl 3-(aminomethyl)imidazo[1,2-a]pyridine-8-carboxylate.

Molecular Properties

Compound Namemethyl 3-(aminomethyl)imidazo[1,2-a]pyridine-8-carboxylate
PubChem CID117256872
Molecular FormulaC10H11N3O2
Molecular Weight205.22 g/mol
Exact Mass205.09
IUPAC Namemethyl 3-(aminomethyl)imidazo[1,2-a]pyridine-8-carboxylate
SMILESCOC(=O)c1cccn2c(CN)cnc12
InChIInChI=1S/C10H11N3O2/c1-15-10(14)8-3-2-4-13-7(5-11)6-12-9(8)13/h2-4,6H,5,11H2,1H3
InChIKeyBJJDHYMYDZGLLA-UHFFFAOYSA-N
XLogP0.58
TPSA69.62 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.22
LogP ≤ 50.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 3-(aminomethyl)imidazo[1,2-a]pyridine-8-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(aminomethyl)imidazo[1,2-a]pyridine-8-carboxylate?
The IUPAC name of methyl 3-(aminomethyl)imidazo[1,2-a]pyridine-8-carboxylate (CID 117256872) is methyl 3-(aminomethyl)imidazo[1,2-a]pyridine-8-carboxylate.
What is the SMILES notation for methyl 3-(aminomethyl)imidazo[1,2-a]pyridine-8-carboxylate?
The canonical SMILES for methyl 3-(aminomethyl)imidazo[1,2-a]pyridine-8-carboxylate is COC(=O)c1cccn2c(CN)cnc12.
What is the InChIKey of methyl 3-(aminomethyl)imidazo[1,2-a]pyridine-8-carboxylate?
The InChIKey is BJJDHYMYDZGLLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2/c1-15-10(14)8-3-2-4-13-7(5-11)6-12-9(8)13/h2-4,6H,5,11H2,1H3.
What are the key properties of methyl 3-(aminomethyl)imidazo[1,2-a]pyridine-8-carboxylate?
methyl 3-(aminomethyl)imidazo[1,2-a]pyridine-8-carboxylate has a molecular weight of 205.22 g/mol, XLogP of 0.58, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(aminomethyl)imidazo[1,2-a]pyridine-8-carboxylate is sourced from PubChem (CID 117256872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).