C9H8N2O2S — CID 117256926
3-(sulfanylmethyl)imidazo[1,2-a]pyridine-8-carboxylic acid (PubChem CID 117256926) has the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. Its IUPAC name is 3-(sulfanylmethyl)imidazo[1,2-a]pyridine-8-carboxylic acid.
| Compound Name | 3-(sulfanylmethyl)imidazo[1,2-a]pyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 117256926 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 3-(sulfanylmethyl)imidazo[1,2-a]pyridine-8-carboxylic acid |
| SMILES | O=C(O)c1cccn2c(CS)cnc12 |
| InChI | InChI=1S/C9H8N2O2S/c12-9(13)7-2-1-3-11-6(5-14)4-10-8(7)11/h1-4,14H,5H2,(H,12,13) |
| InChIKey | QRELABVLPOQQEZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|