imidazo[1,2-a]pyridine-8-carboxylic acid

C8H6N2O2 — CID 11715357

IUPACimidazo[1,2-a]pyridine-8-carboxylic acid
SMILESO=C(O)c1cccn2ccnc12
InChIInChI=1S/C8H6N2O2/c11-8(12)6-2-1-4-10-5-3-9-7(6)10/h1-5H,(H,11,12)
InChIKeyWHOCKNWCRFHEMH-UHFFFAOYSA-N
MW162.15 g/mol
LogP1.03
Rot. Bonds1

About imidazo[1,2-a]pyridine-8-carboxylic acid

imidazo[1,2-a]pyridine-8-carboxylic acid (PubChem CID 11715357) has the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. Its IUPAC name is imidazo[1,2-a]pyridine-8-carboxylic acid.

Molecular Properties

Compound Nameimidazo[1,2-a]pyridine-8-carboxylic acid
PubChem CID11715357
Molecular FormulaC8H6N2O2
Molecular Weight162.15 g/mol
Exact Mass162.04
IUPAC Nameimidazo[1,2-a]pyridine-8-carboxylic acid
SMILESO=C(O)c1cccn2ccnc12
InChIInChI=1S/C8H6N2O2/c11-8(12)6-2-1-4-10-5-3-9-7(6)10/h1-5H,(H,11,12)
InChIKeyWHOCKNWCRFHEMH-UHFFFAOYSA-N
XLogP1.03
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.15
LogP ≤ 51.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze imidazo[1,2-a]pyridine-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of imidazo[1,2-a]pyridine-8-carboxylic acid?
The IUPAC name of imidazo[1,2-a]pyridine-8-carboxylic acid (CID 11715357) is imidazo[1,2-a]pyridine-8-carboxylic acid.
What is the SMILES notation for imidazo[1,2-a]pyridine-8-carboxylic acid?
The canonical SMILES for imidazo[1,2-a]pyridine-8-carboxylic acid is O=C(O)c1cccn2ccnc12.
What is the InChIKey of imidazo[1,2-a]pyridine-8-carboxylic acid?
The InChIKey is WHOCKNWCRFHEMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2/c11-8(12)6-2-1-4-10-5-3-9-7(6)10/h1-5H,(H,11,12).
What are the key properties of imidazo[1,2-a]pyridine-8-carboxylic acid?
imidazo[1,2-a]pyridine-8-carboxylic acid has a molecular weight of 162.15 g/mol, XLogP of 1.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-a]pyridine-8-carboxylic acid is sourced from PubChem (CID 11715357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).