C13H15N3O — CID 110704345
imidazo[1,2-a]pyridin-8-yl(piperidin-1-yl)methanone (PubChem CID 110704345) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-8-yl(piperidin-1-yl)methanone.
| Compound Name | imidazo[1,2-a]pyridin-8-yl(piperidin-1-yl)methanone |
|---|---|
| PubChem CID | 110704345 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | imidazo[1,2-a]pyridin-8-yl(piperidin-1-yl)methanone |
| SMILES | O=C(c1cccn2ccnc12)N1CCCCC1 |
| InChI | InChI=1S/C13H15N3O/c17-13(16-7-2-1-3-8-16)11-5-4-9-15-10-6-14-12(11)15/h4-6,9-10H,1-3,7-8H2 |
| InChIKey | ONLUKDMWYUSYDM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |