C16H16N4O — CID 110704495
N-[4-(dimethylamino)phenyl]imidazo[1,2-a]pyridine-8-carboxamide (PubChem CID 110704495) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]imidazo[1,2-a]pyridine-8-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]imidazo[1,2-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 110704495 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]imidazo[1,2-a]pyridine-8-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cccn3ccnc23)cc1 |
| InChI | InChI=1S/C16H16N4O/c1-19(2)13-7-5-12(6-8-13)18-16(21)14-4-3-10-20-11-9-17-15(14)20/h3-11H,1-2H3,(H,18,21) |
| InChIKey | DPRLXHUHJUYFIX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|