C14H14N6O — CID 821873
N-[4-(dimethylamino)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 821873) has the molecular formula C14H14N6O and a molecular weight of 282.31 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 821873 |
| Molecular Formula | C14H14N6O |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2nc3ncccn3n2)cc1 |
| InChI | InChI=1S/C14H14N6O/c1-19(2)11-6-4-10(5-7-11)16-13(21)12-17-14-15-8-3-9-20(14)18-12/h3-9H,1-2H3,(H,16,21) |
| InChIKey | SSCFOZAWIDOYIG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|