C12H17N5O — CID 171315776
N-hexyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 171315776) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is N-hexyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-hexyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 171315776 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-hexyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CCCCCCNC(=O)c1nc2ncccn2n1 |
| InChI | InChI=1S/C12H17N5O/c1-2-3-4-5-7-13-11(18)10-15-12-14-8-6-9-17(12)16-10/h6,8-9H,2-5,7H2,1H3,(H,13,18) |
| InChIKey | XYCMFXVXMOEFMJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|