C15H23N5O — CID 94649440
N-[(2R)-octan-2-yl]-2-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetamide (PubChem CID 94649440) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[(2R)-octan-2-yl]-2-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetamide.
| Compound Name | N-[(2R)-octan-2-yl]-2-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetamide |
|---|---|
| PubChem CID | 94649440 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | N-[(2R)-octan-2-yl]-2-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetamide |
| SMILES | CCCCCC[C@@H](C)NC(=O)Cc1nc2ncccn2n1 |
| InChI | InChI=1S/C15H23N5O/c1-3-4-5-6-8-12(2)17-14(21)11-13-18-15-16-9-7-10-20(15)19-13/h7,9-10,12H,3-6,8,11H2,1-2H3,(H,17,21)/t12-/m1/s1 |
| InChIKey | YPTNOEBOQUODGE-GFCCVEGCSA-N |
| XLogP | 2.14 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|