C10H12N4O2 — CID 2068816
butyl [1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 2068816) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is butyl [1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | butyl [1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 2068816 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | butyl [1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | CCCCOC(=O)c1nc2ncccn2n1 |
| InChI | InChI=1S/C10H12N4O2/c1-2-3-7-16-9(15)8-12-10-11-5-4-6-14(10)13-8/h4-6H,2-3,7H2,1H3 |
| InChIKey | WDURIAMRQLAEFC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|