C16H23N3OS — CID 42652289
N-heptan-2-yl-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide (PubChem CID 42652289) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is N-heptan-2-yl-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-heptan-2-yl-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 42652289 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | N-heptan-2-yl-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide |
| SMILES | CCCCCC(C)NC(=O)Cc1cnc(-n2cccc2)s1 |
| InChI | InChI=1S/C16H23N3OS/c1-3-4-5-8-13(2)18-15(20)11-14-12-17-16(21-14)19-9-6-7-10-19/h6-7,9-10,12-13H,3-5,8,11H2,1-2H3,(H,18,20) |
| InChIKey | VAYUOXCECZFWMB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|