C15H10N4O — CID 110475069
benzimidazol-1-yl(imidazo[1,2-a]pyridin-8-yl)methanone (PubChem CID 110475069) has the molecular formula C15H10N4O and a molecular weight of 262.27 g/mol. Its IUPAC name is benzimidazol-1-yl(imidazo[1,2-a]pyridin-8-yl)methanone.
| Compound Name | benzimidazol-1-yl(imidazo[1,2-a]pyridin-8-yl)methanone |
|---|---|
| PubChem CID | 110475069 |
| Molecular Formula | C15H10N4O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | benzimidazol-1-yl(imidazo[1,2-a]pyridin-8-yl)methanone |
| SMILES | O=C(c1cccn2ccnc12)n1cnc2ccccc21 |
| InChI | InChI=1S/C15H10N4O/c20-15(11-4-3-8-18-9-7-16-14(11)18)19-10-17-12-5-1-2-6-13(12)19/h1-10H |
| InChIKey | OFMVHIKLPHQXOM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |