C11H14N4O — CID 104733557
(3-pyrazolo[1,5-a]pyrazin-4-yloxycyclobutyl)methanamine (PubChem CID 104733557) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is (3-pyrazolo[1,5-a]pyrazin-4-yloxycyclobutyl)methanamine.
| Compound Name | (3-pyrazolo[1,5-a]pyrazin-4-yloxycyclobutyl)methanamine |
|---|---|
| PubChem CID | 104733557 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | (3-pyrazolo[1,5-a]pyrazin-4-yloxycyclobutyl)methanamine |
| SMILES | NCC1CC(Oc2nccn3nccc23)C1 |
| InChI | InChI=1S/C11H14N4O/c12-7-8-5-9(6-8)16-11-10-1-2-14-15(10)4-3-13-11/h1-4,8-9H,5-7,12H2 |
| InChIKey | FUNVQFHSLYKFOH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |