C10H13N3O — CID 102626860
2-imidazo[1,2-a]pyridin-5-yloxy-N-methylethanamine (PubChem CID 102626860) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-imidazo[1,2-a]pyridin-5-yloxy-N-methylethanamine.
| Compound Name | 2-imidazo[1,2-a]pyridin-5-yloxy-N-methylethanamine |
|---|---|
| PubChem CID | 102626860 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-imidazo[1,2-a]pyridin-5-yloxy-N-methylethanamine |
| SMILES | CNCCOc1cccc2nccn12 |
| InChI | InChI=1S/C10H13N3O/c1-11-6-8-14-10-4-2-3-9-12-5-7-13(9)10/h2-5,7,11H,6,8H2,1H3 |
| InChIKey | MJUZBRDXKBMOOE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|