C11H15N3O — CID 115883524
N-(imidazo[1,2-a]pyridin-5-ylmethyl)-2-methoxyethanamine (PubChem CID 115883524) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyridin-5-ylmethyl)-2-methoxyethanamine.
| Compound Name | N-(imidazo[1,2-a]pyridin-5-ylmethyl)-2-methoxyethanamine |
|---|---|
| PubChem CID | 115883524 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | N-(imidazo[1,2-a]pyridin-5-ylmethyl)-2-methoxyethanamine |
| SMILES | COCCNCc1cccc2nccn12 |
| InChI | InChI=1S/C11H15N3O/c1-15-8-6-12-9-10-3-2-4-11-13-5-7-14(10)11/h2-5,7,12H,6,8-9H2,1H3 |
| InChIKey | TWIBSNPZRLUPFL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|