C12H13N3 — CID 115883630
N-(imidazo[1,2-a]pyridin-5-ylmethyl)but-2-yn-1-amine (PubChem CID 115883630) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyridin-5-ylmethyl)but-2-yn-1-amine.
| Compound Name | N-(imidazo[1,2-a]pyridin-5-ylmethyl)but-2-yn-1-amine |
|---|---|
| PubChem CID | 115883630 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | N-(imidazo[1,2-a]pyridin-5-ylmethyl)but-2-yn-1-amine |
| SMILES | CC#CCNCc1cccc2nccn12 |
| InChI | InChI=1S/C12H13N3/c1-2-3-7-13-10-11-5-4-6-12-14-8-9-15(11)12/h4-6,8-9,13H,7,10H2,1H3 |
| InChIKey | RSAVVSIEZGYWRI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|