C15H22N4 — CID 115306698
3-[2-(cycloheptylamino)ethylamino]pyridine-2-carbonitrile (PubChem CID 115306698) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 3-[2-(cycloheptylamino)ethylamino]pyridine-2-carbonitrile.
| Compound Name | 3-[2-(cycloheptylamino)ethylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 115306698 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 3-[2-(cycloheptylamino)ethylamino]pyridine-2-carbonitrile |
| SMILES | N#Cc1ncccc1NCCNC1CCCCCC1 |
| InChI | InChI=1S/C15H22N4/c16-12-15-14(8-5-9-18-15)19-11-10-17-13-6-3-1-2-4-7-13/h5,8-9,13,17,19H,1-4,6-7,10-11H2 |
| InChIKey | QTGDOLPYELIADT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|