C13H17N3 — CID 107418642
3-[(2-methylcyclopentyl)methylamino]pyridine-2-carbonitrile (PubChem CID 107418642) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-[(2-methylcyclopentyl)methylamino]pyridine-2-carbonitrile.
| Compound Name | 3-[(2-methylcyclopentyl)methylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 107418642 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 3-[(2-methylcyclopentyl)methylamino]pyridine-2-carbonitrile |
| SMILES | CC1CCCC1CNc1cccnc1C#N |
| InChI | InChI=1S/C13H17N3/c1-10-4-2-5-11(10)9-16-12-6-3-7-15-13(12)8-14/h3,6-7,10-11,16H,2,4-5,9H2,1H3 |
| InChIKey | QPTNDMAQXTWWGW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |