C14H12N4O — CID 103204536
2-[(1,2,4-benzotriazin-3-ylamino)methyl]phenol (PubChem CID 103204536) has the molecular formula C14H12N4O and a molecular weight of 252.28 g/mol. Its IUPAC name is 2-[(1,2,4-benzotriazin-3-ylamino)methyl]phenol.
| Compound Name | 2-[(1,2,4-benzotriazin-3-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 103204536 |
| Molecular Formula | C14H12N4O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-[(1,2,4-benzotriazin-3-ylamino)methyl]phenol |
| SMILES | Oc1ccccc1CNc1nnc2ccccc2n1 |
| InChI | InChI=1S/C14H12N4O/c19-13-8-4-1-5-10(13)9-15-14-16-11-6-2-3-7-12(11)17-18-14/h1-8,19H,9H2,(H,15,16,18) |
| InChIKey | QEJHBVFMQKLNJY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|