C14H13N5O — CID 103204100
N-[(2-methoxy-3-pyridinyl)methyl]-1,2,4-benzotriazin-3-amine (PubChem CID 103204100) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is N-[(2-methoxy-3-pyridinyl)methyl]-1,2,4-benzotriazin-3-amine.
| Compound Name | N-[(2-methoxy-3-pyridinyl)methyl]-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 103204100 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | N-[(2-methoxy-3-pyridinyl)methyl]-1,2,4-benzotriazin-3-amine |
| SMILES | COc1ncccc1CNc1nnc2ccccc2n1 |
| InChI | InChI=1S/C14H13N5O/c1-20-13-10(5-4-8-15-13)9-16-14-17-11-6-2-3-7-12(11)18-19-14/h2-8H,9H2,1H3,(H,16,17,19) |
| InChIKey | AFRPZKPOVXYNRR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |