C14H14N4S — CID 106013235
N-[(5-ethylthiophen-2-yl)methyl]-1,2,4-benzotriazin-3-amine (PubChem CID 106013235) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is N-[(5-ethylthiophen-2-yl)methyl]-1,2,4-benzotriazin-3-amine.
| Compound Name | N-[(5-ethylthiophen-2-yl)methyl]-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 106013235 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | N-[(5-ethylthiophen-2-yl)methyl]-1,2,4-benzotriazin-3-amine |
| SMILES | CCc1ccc(CNc2nnc3ccccc3n2)s1 |
| InChI | InChI=1S/C14H14N4S/c1-2-10-7-8-11(19-10)9-15-14-16-12-5-3-4-6-13(12)17-18-14/h3-8H,2,9H2,1H3,(H,15,16,18) |
| InChIKey | KNVUFWADXVEYPX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |