C11H15N5O2S — CID 106337308
N-[3-(1,2,4-benzotriazin-3-ylamino)propyl]methanesulfonamide (PubChem CID 106337308) has the molecular formula C11H15N5O2S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-[3-(1,2,4-benzotriazin-3-ylamino)propyl]methanesulfonamide.
| Compound Name | N-[3-(1,2,4-benzotriazin-3-ylamino)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106337308 |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | N-[3-(1,2,4-benzotriazin-3-ylamino)propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCNc1nnc2ccccc2n1 |
| InChI | InChI=1S/C11H15N5O2S/c1-19(17,18)13-8-4-7-12-11-14-9-5-2-3-6-10(9)15-16-11/h2-3,5-6,13H,4,7-8H2,1H3,(H,12,14,16) |
| InChIKey | RBJVUPZVYKIPLP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|