C14H19N3O2 — CID 47283189
3-(1,3-benzoxazol-2-ylamino)-N,N-diethylpropanamide (PubChem CID 47283189) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-ylamino)-N,N-diethylpropanamide.
| Compound Name | 3-(1,3-benzoxazol-2-ylamino)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 47283189 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-(1,3-benzoxazol-2-ylamino)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNc1nc2ccccc2o1 |
| InChI | InChI=1S/C14H19N3O2/c1-3-17(4-2)13(18)9-10-15-14-16-11-7-5-6-8-12(11)19-14/h5-8H,3-4,9-10H2,1-2H3,(H,15,16) |
| InChIKey | IYXCRIVZTBOUJR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |