About Benzoxazole
Benzoxazole (PubChem CID 9228) has the molecular formula C7H5NO
and a molecular weight of 119.12 g/mol. Its IUPAC name is 1,3-benzoxazole.
Molecular Properties
| Compound Name | Benzoxazole |
| PubChem CID | 9228 |
| Molecular Formula | C7H5NO |
| Molecular Weight | 119.12 g/mol |
| Exact Mass | 119.04 |
| IUPAC Name | 1,3-benzoxazole |
| SMILES | C1=CC=C2C(=C1)N=CO2 |
| InChI | InChI=1S/C7H5NO/c1-2-4-7-6(3-1)8-5-9-7/h1-5H |
| InChIKey | BCMCBBGGLRIHSE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | 105 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.12 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Benzoxazole?
The IUPAC name of Benzoxazole (CID 9228) is 1,3-benzoxazole.
What is the SMILES notation for Benzoxazole?
The canonical SMILES for Benzoxazole is C1=CC=C2C(=C1)N=CO2.
What is the InChIKey of Benzoxazole?
The InChIKey is BCMCBBGGLRIHSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO/c1-2-4-7-6(3-1)8-5-9-7/h1-5H.
What are the key properties of Benzoxazole?
Benzoxazole has a molecular weight of 119.12 g/mol, XLogP of 1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Benzoxazole is sourced from PubChem (CID 9228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).