C28H25NO2 — CID 142500266
3-(2,2-dimethyl-1,3-benzodioxol-5-yl)-4-methyl-N,N-diphenylaniline (PubChem CID 142500266) has the molecular formula C28H25NO2 and a molecular weight of 407.51 g/mol. Its IUPAC name is 3-(2,2-dimethyl-1,3-benzodioxol-5-yl)-4-methyl-N,N-diphenylaniline.
| Compound Name | 3-(2,2-dimethyl-1,3-benzodioxol-5-yl)-4-methyl-N,N-diphenylaniline |
|---|---|
| PubChem CID | 142500266 |
| Molecular Formula | C28H25NO2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 3-(2,2-dimethyl-1,3-benzodioxol-5-yl)-4-methyl-N,N-diphenylaniline |
| SMILES | Cc1ccc(N(c2ccccc2)c2ccccc2)cc1-c1ccc2c(c1)OC(C)(C)O2 |
| InChI | InChI=1S/C28H25NO2/c1-20-14-16-24(29(22-10-6-4-7-11-22)23-12-8-5-9-13-23)19-25(20)21-15-17-26-27(18-21)31-28(2,3)30-26/h4-19H,1-3H3 |
| InChIKey | RHSVMBROMGQHQP-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |