C45H49N — CID 154592851
N-[[2-(1,1,2,2,3,3-hexamethylinden-5-yl)phenyl]methyl]-7,9,9-trimethyl-N-(3-methylphenyl)fluoren-2-amine (PubChem CID 154592851) has the molecular formula C45H49N and a molecular weight of 603.89 g/mol. Its IUPAC name is N-[[2-(1,1,2,2,3,3-hexamethylinden-5-yl)phenyl]methyl]-7,9,9-trimethyl-N-(3-methylphenyl)fluoren-2-amine.
| Compound Name | N-[[2-(1,1,2,2,3,3-hexamethylinden-5-yl)phenyl]methyl]-7,9,9-trimethyl-N-(3-methylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 154592851 |
| Molecular Formula | C45H49N |
| Molecular Weight | 603.89 g/mol |
| Exact Mass | 603.39 |
| IUPAC Name | N-[[2-(1,1,2,2,3,3-hexamethylinden-5-yl)phenyl]methyl]-7,9,9-trimethyl-N-(3-methylphenyl)fluoren-2-amine |
| SMILES | Cc1cccc(N(Cc2ccccc2-c2ccc3c(c2)C(C)(C)C(C)(C)C3(C)C)c2ccc3c(c2)C(C)(C)c2cc(C)ccc2-3)c1 |
| InChI | InChI=1S/C45H49N/c1-29-14-13-16-33(24-29)46(34-20-22-37-36-21-18-30(2)25-39(36)42(3,4)40(37)27-34)28-32-15-11-12-17-35(32)31-19-23-38-41(26-31)44(7,8)45(9,10)43(38,5)6/h11-27H,28H2,1-10H3 |
| InChIKey | ARDDVUQFXRGRAO-UHFFFAOYSA-N |
| XLogP | 12.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.89 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |