C26H31N3 — CID 118857218
2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-4,6-dimethylpyrimidine (PubChem CID 118857218) has the molecular formula C26H31N3 and a molecular weight of 385.56 g/mol. Its IUPAC name is 2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-4,6-dimethylpyrimidine.
| Compound Name | 2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 118857218 |
| Molecular Formula | C26H31N3 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(-c2ccc(-c3ccc4c(c3)C(C)(C)C(C)(C)C4(C)C)nc2)n1 |
| InChI | InChI=1S/C26H31N3/c1-16-13-17(2)29-23(28-16)19-10-12-22(27-15-19)18-9-11-20-21(14-18)25(5,6)26(7,8)24(20,3)4/h9-15H,1-8H3 |
| InChIKey | RMXGDEZHIZVYIO-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |