C30H32N4S — CID 118857458
2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-4-methyl-6-phenylsulfanyl-1,3,5-triazine (PubChem CID 118857458) has the molecular formula C30H32N4S and a molecular weight of 480.68 g/mol. Its IUPAC name is 2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-4-methyl-6-phenylsulfanyl-1,3,5-triazine.
| Compound Name | 2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-4-methyl-6-phenylsulfanyl-1,3,5-triazine |
|---|---|
| PubChem CID | 118857458 |
| Molecular Formula | C30H32N4S |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-4-methyl-6-phenylsulfanyl-1,3,5-triazine |
| SMILES | Cc1nc(Sc2ccccc2)nc(-c2ccc(-c3ccc4c(c3)C(C)(C)C(C)(C)C4(C)C)nc2)n1 |
| InChI | InChI=1S/C30H32N4S/c1-19-32-26(34-27(33-19)35-22-11-9-8-10-12-22)21-14-16-25(31-18-21)20-13-15-23-24(17-20)29(4,5)30(6,7)28(23,2)3/h8-18H,1-7H3 |
| InChIKey | ORSXIDZMGGSUJD-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |