C31H34N4 — CID 130376249
2-benzyl-4-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-6-methyl-1,3,5-triazine (PubChem CID 130376249) has the molecular formula C31H34N4 and a molecular weight of 462.64 g/mol. Its IUPAC name is 2-benzyl-4-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-6-methyl-1,3,5-triazine.
| Compound Name | 2-benzyl-4-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-6-methyl-1,3,5-triazine |
|---|---|
| PubChem CID | 130376249 |
| Molecular Formula | C31H34N4 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 2-benzyl-4-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-6-methyl-1,3,5-triazine |
| SMILES | Cc1nc(Cc2ccccc2)nc(-c2ccc(-c3ccc4c(c3)C(C)(C)C(C)(C)C4(C)C)nc2)n1 |
| InChI | InChI=1S/C31H34N4/c1-20-33-27(17-21-11-9-8-10-12-21)35-28(34-20)23-14-16-26(32-19-23)22-13-15-24-25(18-22)30(4,5)31(6,7)29(24,2)3/h8-16,18-19H,17H2,1-7H3 |
| InChIKey | KJKMZBIGEHVDCM-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |