C57H44F2N4 — CID 130376269
2-[6-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-3-pyridinyl]-4,6-bis[3-(3-phenylphenyl)phenyl]-1,3,5-triazine (PubChem CID 130376269) has the molecular formula C57H44F2N4 and a molecular weight of 823.00 g/mol. Its IUPAC name is 2-[6-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-3-pyridinyl]-4,6-bis[3-(3-phenylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-[6-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-3-pyridinyl]-4,6-bis[3-(3-phenylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 130376269 |
| Molecular Formula | C57H44F2N4 |
| Molecular Weight | 823.00 g/mol |
| Exact Mass | 822.35 |
| IUPAC Name | 2-[6-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-3-pyridinyl]-4,6-bis[3-(3-phenylphenyl)phenyl]-1,3,5-triazine |
| SMILES | CC1(C)c2ccc(-c3ccc(-c4nc(-c5cccc(-c6cccc(-c7ccccc7)c6)c5)nc(-c5cccc(-c6cccc(-c7ccccc7)c6)c5)n4)cn3)cc2C(C)(C)C1(F)F |
| InChI | InChI=1S/C57H44F2N4/c1-55(2)49-29-27-45(35-50(49)56(3,4)57(55,58)59)51-30-28-48(36-60-51)54-62-52(46-25-13-23-43(33-46)41-21-11-19-39(31-41)37-15-7-5-8-16-37)61-53(63-54)47-26-14-24-44(34-47)42-22-12-20-40(32-42)38-17-9-6-10-18-38/h5-36H,1-4H3 |
| InChIKey | IDKZCHCRMVILSX-UHFFFAOYSA-N |
| XLogP | 14.81 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.00 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |