C43H54N4 — CID 130376256
2,4-bis(1-adamantyl)-6-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-1,3,5-triazine (PubChem CID 130376256) has the molecular formula C43H54N4 and a molecular weight of 626.93 g/mol. Its IUPAC name is 2,4-bis(1-adamantyl)-6-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(1-adamantyl)-6-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 130376256 |
| Molecular Formula | C43H54N4 |
| Molecular Weight | 626.93 g/mol |
| Exact Mass | 626.43 |
| IUPAC Name | 2,4-bis(1-adamantyl)-6-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-1,3,5-triazine |
| SMILES | CC1(C)c2ccc(-c3ccc(-c4nc(C56CC7CC(CC(C7)C5)C6)nc(C56CC7CC(CC(C7)C5)C6)n4)cn3)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C43H54N4/c1-39(2)33-9-7-31(17-34(33)40(3,4)41(39,5)6)35-10-8-32(24-44-35)36-45-37(42-18-25-11-26(19-42)13-27(12-25)20-42)47-38(46-36)43-21-28-14-29(22-43)16-30(15-28)23-43/h7-10,17,24-30H,11-16,18-23H2,1-6H3 |
| InChIKey | SNWSBFRDCBEUTJ-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.93 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |