C44H51N3 — CID 140826425
2,4-bis(4-tert-butylphenyl)-6-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]pyrimidine (PubChem CID 140826425) has the molecular formula C44H51N3 and a molecular weight of 621.91 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylphenyl)-6-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]pyrimidine.
| Compound Name | 2,4-bis(4-tert-butylphenyl)-6-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]pyrimidine |
|---|---|
| PubChem CID | 140826425 |
| Molecular Formula | C44H51N3 |
| Molecular Weight | 621.91 g/mol |
| Exact Mass | 621.41 |
| IUPAC Name | 2,4-bis(4-tert-butylphenyl)-6-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]pyrimidine |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3ccc(-c4ccc5c(c4)C(C)(C)C(C)(C)C5(C)C)nc3)nc(-c3ccc(C(C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C44H51N3/c1-40(2,3)32-19-13-28(14-20-32)37-26-38(47-39(46-37)29-15-21-33(22-16-29)41(4,5)6)31-18-24-36(45-27-31)30-17-23-34-35(25-30)43(9,10)44(11,12)42(34,7)8/h13-27H,1-12H3 |
| InChIKey | FXEMZWGKBYFSNE-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.91 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |