C42H48N4 — CID 138461260
2-(4-tert-butylphenyl)-4-[4-(2-methylbutan-2-yl)phenyl]-6-[6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-3-pyridinyl]-1,3,5-triazine (PubChem CID 138461260) has the molecular formula C42H48N4 and a molecular weight of 608.87 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-4-[4-(2-methylbutan-2-yl)phenyl]-6-[6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-3-pyridinyl]-1,3,5-triazine.
| Compound Name | 2-(4-tert-butylphenyl)-4-[4-(2-methylbutan-2-yl)phenyl]-6-[6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-3-pyridinyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 138461260 |
| Molecular Formula | C42H48N4 |
| Molecular Weight | 608.87 g/mol |
| Exact Mass | 608.39 |
| IUPAC Name | 2-(4-tert-butylphenyl)-4-[4-(2-methylbutan-2-yl)phenyl]-6-[6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-3-pyridinyl]-1,3,5-triazine |
| SMILES | CCC(C)(C)c1ccc(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3ccc(-c4ccc5c(c4)C(C)(C)CC5(C)C)nc3)n2)cc1 |
| InChI | InChI=1S/C42H48N4/c1-11-40(5,6)32-20-14-28(15-21-32)37-44-36(27-12-18-31(19-13-27)39(2,3)4)45-38(46-37)30-17-23-35(43-25-30)29-16-22-33-34(24-29)42(9,10)26-41(33,7)8/h12-25H,11,26H2,1-10H3 |
| InChIKey | OQZWHYPPNBQXSL-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.87 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |