C39H43N5 — CID 130376275
5-[5-[4,6-bis(4-propan-2-ylphenyl)-1,3,5-triazin-2-yl]-2-pyridinyl]-1,1,2,3,3-pentamethylisoindole (PubChem CID 130376275) has the molecular formula C39H43N5 and a molecular weight of 581.81 g/mol. Its IUPAC name is 5-[5-[4,6-bis(4-propan-2-ylphenyl)-1,3,5-triazin-2-yl]-2-pyridinyl]-1,1,2,3,3-pentamethylisoindole.
| Compound Name | 5-[5-[4,6-bis(4-propan-2-ylphenyl)-1,3,5-triazin-2-yl]-2-pyridinyl]-1,1,2,3,3-pentamethylisoindole |
|---|---|
| PubChem CID | 130376275 |
| Molecular Formula | C39H43N5 |
| Molecular Weight | 581.81 g/mol |
| Exact Mass | 581.35 |
| IUPAC Name | 5-[5-[4,6-bis(4-propan-2-ylphenyl)-1,3,5-triazin-2-yl]-2-pyridinyl]-1,1,2,3,3-pentamethylisoindole |
| SMILES | CC(C)c1ccc(-c2nc(-c3ccc(C(C)C)cc3)nc(-c3ccc(-c4ccc5c(c4)C(C)(C)N(C)C5(C)C)nc3)n2)cc1 |
| InChI | InChI=1S/C39H43N5/c1-24(2)26-10-14-28(15-11-26)35-41-36(29-16-12-27(13-17-29)25(3)4)43-37(42-35)31-19-21-34(40-23-31)30-18-20-32-33(22-30)39(7,8)44(9)38(32,5)6/h10-25H,1-9H3 |
| InChIKey | YXAZKOIFUWOZNZ-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.81 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |