C37H46N4 — CID 140826343
2,4-ditert-butyl-6-[4-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]phenyl]-1,3,5-triazine (PubChem CID 140826343) has the molecular formula C37H46N4 and a molecular weight of 546.80 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[4-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-ditert-butyl-6-[4-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 140826343 |
| Molecular Formula | C37H46N4 |
| Molecular Weight | 546.80 g/mol |
| Exact Mass | 546.37 |
| IUPAC Name | 2,4-ditert-butyl-6-[4-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2ccc(-c3ccc(-c4ccc5c(c4)C(C)(C)C(C)(C)C5(C)C)nc3)cc2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C37H46N4/c1-33(2,3)31-39-30(40-32(41-31)34(4,5)6)24-15-13-23(14-16-24)26-18-20-29(38-22-26)25-17-19-27-28(21-25)36(9,10)37(11,12)35(27,7)8/h13-22H,1-12H3 |
| InChIKey | JCFOKQKRSPPLFL-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.80 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |