C61H72FN3 — CID 140676999
2-[fluoro-bis[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-pyridinyl]methyl]-6-(1,1,2,2,3,3-hexamethylinden-5-yl)pyridine (PubChem CID 140676999) has the molecular formula C61H72FN3 and a molecular weight of 866.27 g/mol. Its IUPAC name is 2-[fluoro-bis[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-pyridinyl]methyl]-6-(1,1,2,2,3,3-hexamethylinden-5-yl)pyridine.
| Compound Name | 2-[fluoro-bis[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-pyridinyl]methyl]-6-(1,1,2,2,3,3-hexamethylinden-5-yl)pyridine |
|---|---|
| PubChem CID | 140676999 |
| Molecular Formula | C61H72FN3 |
| Molecular Weight | 866.27 g/mol |
| Exact Mass | 865.57 |
| IUPAC Name | 2-[fluoro-bis[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-pyridinyl]methyl]-6-(1,1,2,2,3,3-hexamethylinden-5-yl)pyridine |
| SMILES | CC1(C)c2ccc(-c3cccc(C(F)(c4cccc(-c5ccc6c(c5)C(C)(C)C(C)(C)C6(C)C)n4)c4cccc(-c5ccc6c(c5)C(C)(C)C(C)(C)C6(C)C)n4)n3)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C61H72FN3/c1-52(2)40-31-28-37(34-43(40)55(7,8)58(52,13)14)46-22-19-25-49(63-46)61(62,50-26-20-23-47(64-50)38-29-32-41-44(35-38)56(9,10)59(15,16)53(41,3)4)51-27-21-24-48(65-51)39-30-33-42-45(36-39)57(11,12)60(17,18)54(42,5)6/h19-36H,1-18H3 |
| InChIKey | UAINOHWCQXMIIS-UHFFFAOYSA-N |
| XLogP | 15.92 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.27 |
| LogP ≤ 5 | 15.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |