C54H60N2 — CID 137396596
2-(1,1,2,2,3,3,4-heptamethyl-4,5-dihydroinden-5-yl)-6-[9-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-pyridinyl]fluoren-9-yl]pyridine (PubChem CID 137396596) has the molecular formula C54H60N2 and a molecular weight of 737.09 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4-heptamethyl-4,5-dihydroinden-5-yl)-6-[9-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-pyridinyl]fluoren-9-yl]pyridine.
| Compound Name | 2-(1,1,2,2,3,3,4-heptamethyl-4,5-dihydroinden-5-yl)-6-[9-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-pyridinyl]fluoren-9-yl]pyridine |
|---|---|
| PubChem CID | 137396596 |
| Molecular Formula | C54H60N2 |
| Molecular Weight | 737.09 g/mol |
| Exact Mass | 736.48 |
| IUPAC Name | 2-(1,1,2,2,3,3,4-heptamethyl-4,5-dihydroinden-5-yl)-6-[9-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-pyridinyl]fluoren-9-yl]pyridine |
| SMILES | CC1C2=C(C=CC1c1cccc(C3(c4cccc(-c5ccc6c(c5)C(C)(C)C(C)(C)C6(C)C)n4)c4ccccc4-c4ccccc43)n1)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C54H60N2/c1-33-35(29-31-41-47(33)51(8,9)53(12,13)49(41,4)5)44-25-19-27-46(56-44)54(38-22-16-14-20-36(38)37-21-15-17-23-39(37)54)45-26-18-24-43(55-45)34-28-30-40-42(32-34)50(6,7)52(10,11)48(40,2)3/h14-33,35H,1-13H3 |
| InChIKey | XJUYZFUMSRCFDU-UHFFFAOYSA-N |
| XLogP | 13.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.09 |
| LogP ≤ 5 | 13.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |