C51H40N4 — CID 58756119
7,7,7',7'-tetramethyl-18,18'-spirobi[23,24-diazapentacyclo[17.3.1.12,6.18,12.113,17]hexacosa-1(23),2(26),3,5,8,10,12(25),13(24),14,16,19,21-dodecaene] (PubChem CID 58756119) has the molecular formula C51H40N4 and a molecular weight of 708.91 g/mol. Its IUPAC name is 7,7,7',7'-tetramethyl-18,18'-spirobi[23,24-diazapentacyclo[17.3.1.12,6.18,12.113,17]hexacosa-1(23),2(26),3,5,8,10,12(25),13(24),14,16,19,21-dodecaene].
| Compound Name | 7,7,7',7'-tetramethyl-18,18'-spirobi[23,24-diazapentacyclo[17.3.1.12,6.18,12.113,17]hexacosa-1(23),2(26),3,5,8,10,12(25),13(24),14,16,19,21-dodecaene] |
|---|---|
| PubChem CID | 58756119 |
| Molecular Formula | C51H40N4 |
| Molecular Weight | 708.91 g/mol |
| Exact Mass | 708.33 |
| IUPAC Name | 7,7,7',7'-tetramethyl-18,18'-spirobi[23,24-diazapentacyclo[17.3.1.12,6.18,12.113,17]hexacosa-1(23),2(26),3,5,8,10,12(25),13(24),14,16,19,21-dodecaene] |
| SMILES | CC1(C)c2cccc(c2)-c2cccc(n2)C2(c3cccc(n3)-c3cccc1c3)c1cccc(n1)-c1cccc(c1)C(C)(C)c1cccc(c1)-c1cccc2n1 |
| InChI | InChI=1S/C51H40N4/c1-49(2)37-17-5-13-33(29-37)41-21-9-25-45(52-41)51(46-26-10-22-42(53-46)34-14-6-18-38(49)30-34)47-27-11-23-43(54-47)35-15-7-19-39(31-35)50(3,4)40-20-8-16-36(32-40)44-24-12-28-48(51)55-44/h5-32H,1-4H3 |
| InChIKey | LHHDUCZTCSBSNZ-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.91 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |