C50H43N3O — CID 166511841
2-[6-[9-(3-benzo[g]quinoxalin-3-ylphenyl)-2,7-ditert-butylfluoren-9-yl]-2-pyridinyl]phenol (PubChem CID 166511841) has the molecular formula C50H43N3O and a molecular weight of 701.91 g/mol. Its IUPAC name is 2-[6-[9-(3-benzo[g]quinoxalin-3-ylphenyl)-2,7-ditert-butylfluoren-9-yl]-2-pyridinyl]phenol.
| Compound Name | 2-[6-[9-(3-benzo[g]quinoxalin-3-ylphenyl)-2,7-ditert-butylfluoren-9-yl]-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 166511841 |
| Molecular Formula | C50H43N3O |
| Molecular Weight | 701.91 g/mol |
| Exact Mass | 701.34 |
| IUPAC Name | 2-[6-[9-(3-benzo[g]quinoxalin-3-ylphenyl)-2,7-ditert-butylfluoren-9-yl]-2-pyridinyl]phenol |
| SMILES | CC(C)(C)c1ccc2c(c1)C(c1cccc(-c3cnc4cc5ccccc5cc4n3)c1)(c1cccc(-c3ccccc3O)n1)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C50H43N3O/c1-48(2,3)34-21-23-37-38-24-22-35(49(4,5)6)29-41(38)50(40(37)28-34,47-20-12-18-42(53-47)39-17-9-10-19-46(39)54)36-16-11-15-33(25-36)45-30-51-43-26-31-13-7-8-14-32(31)27-44(43)52-45/h7-30,54H,1-6H3 |
| InChIKey | HJYMSGOOYBCZPD-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.91 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|