C32H31Br2N — CID 166511751
2-bromo-6-[9-(3-bromophenyl)-2,7-ditert-butylfluoren-9-yl]pyridine (PubChem CID 166511751) has the molecular formula C32H31Br2N and a molecular weight of 589.42 g/mol. Its IUPAC name is 2-bromo-6-[9-(3-bromophenyl)-2,7-ditert-butylfluoren-9-yl]pyridine.
| Compound Name | 2-bromo-6-[9-(3-bromophenyl)-2,7-ditert-butylfluoren-9-yl]pyridine |
|---|---|
| PubChem CID | 166511751 |
| Molecular Formula | C32H31Br2N |
| Molecular Weight | 589.42 g/mol |
| Exact Mass | 587.08 |
| IUPAC Name | 2-bromo-6-[9-(3-bromophenyl)-2,7-ditert-butylfluoren-9-yl]pyridine |
| SMILES | CC(C)(C)c1ccc2c(c1)C(c1cccc(Br)c1)(c1cccc(Br)n1)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C32H31Br2N/c1-30(2,3)20-13-15-24-25-16-14-21(31(4,5)6)19-27(25)32(26(24)18-20,22-9-7-10-23(33)17-22)28-11-8-12-29(34)35-28/h7-19H,1-6H3 |
| InChIKey | CWBXPDSJZPDVOM-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.42 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|