C33H35N — CID 140560446
2-(2,7-ditert-butyl-9-phenylfluoren-9-yl)-6-methylpyridine (PubChem CID 140560446) has the molecular formula C33H35N and a molecular weight of 445.65 g/mol. Its IUPAC name is 2-(2,7-ditert-butyl-9-phenylfluoren-9-yl)-6-methylpyridine.
| Compound Name | 2-(2,7-ditert-butyl-9-phenylfluoren-9-yl)-6-methylpyridine |
|---|---|
| PubChem CID | 140560446 |
| Molecular Formula | C33H35N |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | 2-(2,7-ditert-butyl-9-phenylfluoren-9-yl)-6-methylpyridine |
| SMILES | Cc1cccc(C2(c3ccccc3)c3cc(C(C)(C)C)ccc3-c3ccc(C(C)(C)C)cc32)n1 |
| InChI | InChI=1S/C33H35N/c1-22-12-11-15-30(34-22)33(23-13-9-8-10-14-23)28-20-24(31(2,3)4)16-18-26(28)27-19-17-25(21-29(27)33)32(5,6)7/h8-21H,1-7H3 |
| InChIKey | KMJRZDRKFBOGRI-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |