C39H44IrNO2Se- — CID 164814380
CID 164814380 (PubChem CID 164814380) has the molecular formula C39H44IrNO2Se- and a molecular weight of 829.96 g/mol.
| Compound Name | CID 164814380 |
|---|---|
| PubChem CID | 164814380 |
| Molecular Formula | C39H44IrNO2Se- |
| Molecular Weight | 829.96 g/mol |
| Exact Mass | 831.22 |
| IUPAC Name | — |
| SMILES | CC1(C)c2c([c-]cc3ccccc23)-c2nccc3[se]c4cccc1c4c23.CCC(C)(CC)C(=O)/C=C(\O)C(C)(CC)CC.[Ir] |
| InChI | InChI=1S/C24H16NSe.C15H28O2.Ir/c1-24(2)17-8-5-9-18-20(17)21-19(26-18)12-13-25-23(21)16-11-10-14-6-3-4-7-15(14)22(16)24;1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;/h3-10,12-13H,1-2H3;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-; |
| InChIKey | JKAHGYIIVMEEIE-SWPBDETKSA-N |
| XLogP | 10.35 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.96 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|