C24H20FIrN2O3- — CID 153460844
9-fluoro-6-methyl-2-(3H-pyridin-3-id-4-yloxy)benzo[f]isoquinoline;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 153460844) has the molecular formula C24H20FIrN2O3- and a molecular weight of 595.65 g/mol. Its IUPAC name is 9-fluoro-6-methyl-2-(3H-pyridin-3-id-4-yloxy)benzo[f]isoquinoline;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 9-fluoro-6-methyl-2-(3H-pyridin-3-id-4-yloxy)benzo[f]isoquinoline;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 153460844 |
| Molecular Formula | C24H20FIrN2O3- |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 596.11 |
| IUPAC Name | 9-fluoro-6-methyl-2-(3H-pyridin-3-id-4-yloxy)benzo[f]isoquinoline;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.Cc1cc2cnc(Oc3[c-]cncc3)cc2c2cc(F)ccc12.[Ir] |
| InChI | InChI=1S/C19H12FN2O.C5H8O2.Ir/c1-12-8-13-11-22-19(23-15-4-6-21-7-5-15)10-17(13)18-9-14(20)2-3-16(12)18;1-4(6)3-5(2)7;/h2-4,6-11H,1H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | SXGZKZAGRPESPH-LWFKIUJUSA-N |
| XLogP | 5.86 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|