C26H26IrN3O2- — CID 169033046
(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium;3-phenylpyrido[4,3-f]quinazoline (PubChem CID 169033046) has the molecular formula C26H26IrN3O2- and a molecular weight of 604.73 g/mol. Its IUPAC name is (Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium;3-phenylpyrido[4,3-f]quinazoline.
| Compound Name | (Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium;3-phenylpyrido[4,3-f]quinazoline |
|---|---|
| PubChem CID | 169033046 |
| Molecular Formula | C26H26IrN3O2- |
| Molecular Weight | 604.73 g/mol |
| Exact Mass | 605.17 |
| IUPAC Name | (Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium;3-phenylpyrido[4,3-f]quinazoline |
| SMILES | CC(C)C(=O)/C=C(\O)C(C)C.[Ir].[c-]1ccccc1-c1ncc2c(ccc3cnccc32)n1 |
| InChI | InChI=1S/C17H10N3.C9H16O2.Ir/c1-2-4-12(5-3-1)17-19-11-15-14-8-9-18-10-13(14)6-7-16(15)20-17;1-6(2)8(10)5-9(11)7(3)4;/h1-4,6-11H;5-7,10H,1-4H3;/q-1;;/b;8-5-; |
| InChIKey | QIBKBQRMELSJBW-QBBOVCHSSA-N |
| XLogP | 5.95 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.73 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|