C31H35IrN2O3- — CID 153460987
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;4-(4H-pyridin-4-id-3-yloxy)benzo[f]isoquinoline (PubChem CID 153460987) has the molecular formula C31H35IrN2O3- and a molecular weight of 675.85 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;4-(4H-pyridin-4-id-3-yloxy)benzo[f]isoquinoline.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;4-(4H-pyridin-4-id-3-yloxy)benzo[f]isoquinoline |
|---|---|
| PubChem CID | 153460987 |
| Molecular Formula | C31H35IrN2O3- |
| Molecular Weight | 675.85 g/mol |
| Exact Mass | 676.23 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;4-(4H-pyridin-4-id-3-yloxy)benzo[f]isoquinoline |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir].[c-]1ccncc1Oc1nccc2c1ccc1ccccc12 |
| InChI | InChI=1S/C18H11N2O.C13H24O2.Ir/c1-2-6-15-13(4-1)7-8-17-16(15)9-11-20-18(17)21-14-5-3-10-19-12-14;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h1-4,6-12H;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | QFOMSUXREJZLIX-DZTQYQPZSA-N |
| XLogP | 8.24 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.85 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|