C26H32IrNO3S- — CID 153460616
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;4-(phenoxy)thieno[3,2-c]pyridine (PubChem CID 153460616) has the molecular formula C26H32IrNO3S- and a molecular weight of 630.83 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;4-(phenoxy)thieno[3,2-c]pyridine.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;4-(phenoxy)thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 153460616 |
| Molecular Formula | C26H32IrNO3S- |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 631.17 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;4-(phenoxy)thieno[3,2-c]pyridine |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir].[c-]1ccccc1Oc1nccc2sccc12 |
| InChI | InChI=1S/C13H8NOS.C13H24O2.Ir/c1-2-4-10(5-3-1)15-13-11-7-9-16-12(11)6-8-14-13;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h1-4,6-9H;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | CCJKGGLCILNKEW-DZTQYQPZSA-N |
| XLogP | 7.76 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|