C43H48IrN2O2-2 — CID 155607609
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;1-phenyl-4-[4-(6-phenyl-3-pyridinyl)butyl]isoquinoline (PubChem CID 155607609) has the molecular formula C43H48IrN2O2-2 and a molecular weight of 817.09 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;1-phenyl-4-[4-(6-phenyl-3-pyridinyl)butyl]isoquinoline.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;1-phenyl-4-[4-(6-phenyl-3-pyridinyl)butyl]isoquinoline |
|---|---|
| PubChem CID | 155607609 |
| Molecular Formula | C43H48IrN2O2-2 |
| Molecular Weight | 817.09 g/mol |
| Exact Mass | 817.34 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;1-phenyl-4-[4-(6-phenyl-3-pyridinyl)butyl]isoquinoline |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir].[c-]1ccccc1-c1ccc(CCCCc2cnc(-c3[c-]cccc3)c3ccccc23)cn1 |
| InChI | InChI=1S/C30H24N2.C13H24O2.Ir/c1-3-12-24(13-4-1)29-20-19-23(21-31-29)11-7-8-16-26-22-32-30(25-14-5-2-6-15-25)28-18-10-9-17-27(26)28;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h1-6,9-10,12,14,17-22H,7-8,11,16H2;9-11,14H,5-8H2,1-4H3;/q-2;;/b;12-9-; |
| InChIKey | YTKPMWFTUFUPES-DZTQYQPZSA-N |
| XLogP | 11.00 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.09 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|