About ethane;1-ethyl-3-methylbenzene;oct-4-yn-3-one
ethane;1-ethyl-3-methylbenzene;oct-4-yn-3-one (PubChem CID 142120923) has the molecular formula C19H30O
and a molecular weight of 274.45 g/mol. Its IUPAC name is ethane;1-ethyl-3-methylbenzene;oct-4-yn-3-one.
Molecular Properties
| Compound Name | ethane;1-ethyl-3-methylbenzene;oct-4-yn-3-one |
| PubChem CID | 142120923 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | ethane;1-ethyl-3-methylbenzene;oct-4-yn-3-one |
| SMILES | CC.CCCC#CC(=O)CC.CCc1cccc(C)c1 |
| InChI | InChI=1S/C9H12.C8H12O.C2H6/c1-3-9-6-4-5-8(2)7-9;1-3-5-6-7-8(9)4-2;1-2/h4-7H,3H2,1-2H3;3-5H2,1-2H3;1-2H3 |
| InChIKey | MJJLNXBNPLIHET-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethyl-3-methylbenzene;oct-4-yn-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-3-methylbenzene;oct-4-yn-3-one?
The IUPAC name of ethane;1-ethyl-3-methylbenzene;oct-4-yn-3-one (CID 142120923) is ethane;1-ethyl-3-methylbenzene;oct-4-yn-3-one.
What is the SMILES notation for ethane;1-ethyl-3-methylbenzene;oct-4-yn-3-one?
The canonical SMILES for ethane;1-ethyl-3-methylbenzene;oct-4-yn-3-one is CC.CCCC#CC(=O)CC.CCc1cccc(C)c1.
What is the InChIKey of ethane;1-ethyl-3-methylbenzene;oct-4-yn-3-one?
The InChIKey is MJJLNXBNPLIHET-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C8H12O.C2H6/c1-3-9-6-4-5-8(2)7-9;1-3-5-6-7-8(9)4-2;1-2/h4-7H,3H2,1-2H3;3-5H2,1-2H3;1-2H3.
What are the key properties of ethane;1-ethyl-3-methylbenzene;oct-4-yn-3-one?
ethane;1-ethyl-3-methylbenzene;oct-4-yn-3-one has a molecular weight of 274.45 g/mol, XLogP of 5.35, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-3-methylbenzene;oct-4-yn-3-one is sourced from PubChem (CID 142120923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).