C21H29ClO — CID 142208207
ethane;1-ethyl-3-methylbenzene;3,4,5-trimethylbenzoyl chloride (PubChem CID 142208207) has the molecular formula C21H29ClO and a molecular weight of 332.92 g/mol. Its IUPAC name is ethane;1-ethyl-3-methylbenzene;3,4,5-trimethylbenzoyl chloride.
| Compound Name | ethane;1-ethyl-3-methylbenzene;3,4,5-trimethylbenzoyl chloride |
|---|---|
| PubChem CID | 142208207 |
| Molecular Formula | C21H29ClO |
| Molecular Weight | 332.92 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | ethane;1-ethyl-3-methylbenzene;3,4,5-trimethylbenzoyl chloride |
| SMILES | CC.CCc1cccc(C)c1.Cc1cc(C(=O)Cl)cc(C)c1C |
| InChI | InChI=1S/C10H11ClO.C9H12.C2H6/c1-6-4-9(10(11)12)5-7(2)8(6)3;1-3-9-6-4-5-8(2)7-9;1-2/h4-5H,1-3H3;4-7H,3H2,1-2H3;1-2H3 |
| InChIKey | NAGILIGKXIRMPS-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.92 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|